C17H32O6Si — CID 102422001
methyl 2-[(3aS,4R,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]acetate (PubChem CID 102422001) has the molecular formula C17H32O6Si and a molecular weight of 360.52 g/mol. Its IUPAC name is methyl 2-[(3aS,4R,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]acetate.
| Compound Name | methyl 2-[(3aS,4R,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]acetate |
|---|---|
| PubChem CID | 102422001 |
| Molecular Formula | C17H32O6Si |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | methyl 2-[(3aS,4R,6aR)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]acetate |
| SMILES | COC(=O)C[C@H]1OC[C@H]2OC(C)(C)O[C@@]12CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O6Si/c1-15(2,3)24(7,8)21-11-17-12(9-14(18)19-6)20-10-13(17)22-16(4,5)23-17/h12-13H,9-11H2,1-8H3/t12-,13-,17+/m1/s1 |
| InChIKey | DKQFHQTYZSCQNQ-XNJGSVPQSA-N |
| XLogP | 2.86 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|