C10H13NO6 — CID 102422831
[(6R,7S)-7-acetyloxy-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl] acetate (PubChem CID 102422831) has the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. Its IUPAC name is [(6R,7S)-7-acetyloxy-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl] acetate.
| Compound Name | [(6R,7S)-7-acetyloxy-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl] acetate |
|---|---|
| PubChem CID | 102422831 |
| Molecular Formula | C10H13NO6 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | [(6R,7S)-7-acetyloxy-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CN2C(=O)OCC2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C10H13NO6/c1-5(12)16-8-3-11-7(4-15-10(11)14)9(8)17-6(2)13/h7-9H,3-4H2,1-2H3/t7?,8-,9+/m1/s1 |
| InChIKey | ZLRUCQGYXNRNCU-ASODMVGOSA-N |
| XLogP | -0.32 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|