C14H14N2O7 — CID 102426277
dimethyl (1S,2R,3R,9R,10R)-6-oxido-4-oxo-8-oxa-7-aza-6-azoniatetracyclo[8.2.1.02,9.03,7]trideca-5,11-diene-3,5-dicarboxylate (PubChem CID 102426277) has the molecular formula C14H14N2O7 and a molecular weight of 322.27 g/mol. Its IUPAC name is dimethyl (1S,2R,3R,9R,10R)-6-oxido-4-oxo-8-oxa-7-aza-6-azoniatetracyclo[8.2.1.02,9.03,7]trideca-5,11-diene-3,5-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3R,9R,10R)-6-oxido-4-oxo-8-oxa-7-aza-6-azoniatetracyclo[8.2.1.02,9.03,7]trideca-5,11-diene-3,5-dicarboxylate |
|---|---|
| PubChem CID | 102426277 |
| Molecular Formula | C14H14N2O7 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | dimethyl (1S,2R,3R,9R,10R)-6-oxido-4-oxo-8-oxa-7-aza-6-azoniatetracyclo[8.2.1.02,9.03,7]trideca-5,11-diene-3,5-dicarboxylate |
| SMILES | COC(=O)C1=[N+]([O-])N2O[C@H]3[C@H]([C@@H]4C=C[C@H]3C4)[C@]2(C(=O)OC)C1=O |
| InChI | InChI=1S/C14H14N2O7/c1-21-12(18)9-11(17)14(13(19)22-2)8-6-3-4-7(5-6)10(8)23-16(14)15(9)20/h3-4,6-8,10H,5H2,1-2H3/t6-,7+,8+,10-,14-/m1/s1 |
| InChIKey | FGUOKEGLCDWVEN-HUIOKHRCSA-N |
| XLogP | -1.04 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|