C15H21NO2 — CID 102427119
[(2R,3aS,7S)-3a-methyl-2-phenyl-2,3,4,5,6,7-hexahydro-[1,2]oxazolo[2,3-a]pyridin-7-yl]methanol (PubChem CID 102427119) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is [(2R,3aS,7S)-3a-methyl-2-phenyl-2,3,4,5,6,7-hexahydro-[1,2]oxazolo[2,3-a]pyridin-7-yl]methanol.
| Compound Name | [(2R,3aS,7S)-3a-methyl-2-phenyl-2,3,4,5,6,7-hexahydro-[1,2]oxazolo[2,3-a]pyridin-7-yl]methanol |
|---|---|
| PubChem CID | 102427119 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | [(2R,3aS,7S)-3a-methyl-2-phenyl-2,3,4,5,6,7-hexahydro-[1,2]oxazolo[2,3-a]pyridin-7-yl]methanol |
| SMILES | C[C@@]12CCC[C@@H](CO)N1O[C@@H](c1ccccc1)C2 |
| InChI | InChI=1S/C15H21NO2/c1-15-9-5-8-13(11-17)16(15)18-14(10-15)12-6-3-2-4-7-12/h2-4,6-7,13-14,17H,5,8-11H2,1H3/t13-,14+,15-/m0/s1 |
| InChIKey | FVRHANKMYCLMFX-ZNMIVQPWSA-N |
| XLogP | 2.67 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |