C16H24N2O5Si — CID 102427386
methyl 5-[tert-butyl(dimethyl)silyl]oxy-2-diazo-5-(furan-3-yl)-3-oxopentanoate (PubChem CID 102427386) has the molecular formula C16H24N2O5Si and a molecular weight of 352.46 g/mol. Its IUPAC name is methyl 5-[tert-butyl(dimethyl)silyl]oxy-2-diazo-5-(furan-3-yl)-3-oxopentanoate.
| Compound Name | methyl 5-[tert-butyl(dimethyl)silyl]oxy-2-diazo-5-(furan-3-yl)-3-oxopentanoate |
|---|---|
| PubChem CID | 102427386 |
| Molecular Formula | C16H24N2O5Si |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | methyl 5-[tert-butyl(dimethyl)silyl]oxy-2-diazo-5-(furan-3-yl)-3-oxopentanoate |
| SMILES | COC(=O)C(=[N+]=[N-])C(=O)CC(O[Si](C)(C)C(C)(C)C)c1ccoc1 |
| InChI | InChI=1S/C16H24N2O5Si/c1-16(2,3)24(5,6)23-13(11-7-8-22-10-11)9-12(19)14(18-17)15(20)21-4/h7-8,10,13H,9H2,1-6H3 |
| InChIKey | FKCSMEWDRMWILQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 102.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|