C28H37NO5 — CID 102433112
tert-butyl 3-[benzyl(1-phenylethyl)amino]-3-(5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoate (PubChem CID 102433112) has the molecular formula C28H37NO5 and a molecular weight of 467.61 g/mol. Its IUPAC name is tert-butyl 3-[benzyl(1-phenylethyl)amino]-3-(5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoate.
| Compound Name | tert-butyl 3-[benzyl(1-phenylethyl)amino]-3-(5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoate |
|---|---|
| PubChem CID | 102433112 |
| Molecular Formula | C28H37NO5 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | tert-butyl 3-[benzyl(1-phenylethyl)amino]-3-(5-formyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoate |
| SMILES | CC(c1ccccc1)N(Cc1ccccc1)C(CC(=O)OC(C)(C)C)C1OC(C)(C)OC1C=O |
| InChI | InChI=1S/C28H37NO5/c1-20(22-15-11-8-12-16-22)29(18-21-13-9-7-10-14-21)23(17-25(31)33-27(2,3)4)26-24(19-30)32-28(5,6)34-26/h7-16,19-20,23-24,26H,17-18H2,1-6H3 |
| InChIKey | GTAYHFLCSCUKSK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|