C16H33N3O8P2 — CID 102434260
2-[[1,4-bis[[ethyl(hydroxy)phosphoryl]methyl]-6-methyl-1,4-diazepan-6-yl]-(carboxymethyl)amino]acetic acid (PubChem CID 102434260) has the molecular formula C16H33N3O8P2 and a molecular weight of 457.40 g/mol. Its IUPAC name is 2-[[1,4-bis[[ethyl(hydroxy)phosphoryl]methyl]-6-methyl-1,4-diazepan-6-yl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[1,4-bis[[ethyl(hydroxy)phosphoryl]methyl]-6-methyl-1,4-diazepan-6-yl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 102434260 |
| Molecular Formula | C16H33N3O8P2 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 2-[[1,4-bis[[ethyl(hydroxy)phosphoryl]methyl]-6-methyl-1,4-diazepan-6-yl]-(carboxymethyl)amino]acetic acid |
| SMILES | CCP(=O)(O)CN1CCN(CP(=O)(O)CC)CC(C)(N(CC(=O)O)CC(=O)O)C1 |
| InChI | InChI=1S/C16H33N3O8P2/c1-4-28(24,25)12-17-6-7-18(13-29(26,27)5-2)11-16(3,10-17)19(8-14(20)21)9-15(22)23/h4-13H2,1-3H3,(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | MQRZDJHFFWRAKE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 158.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|