C13H11NO3S — CID 102435735
7-nitro-2,3,4,4a-tetrahydrothioxanthen-1-one (PubChem CID 102435735) has the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. Its IUPAC name is 7-nitro-2,3,4,4a-tetrahydrothioxanthen-1-one.
| Compound Name | 7-nitro-2,3,4,4a-tetrahydrothioxanthen-1-one |
|---|---|
| PubChem CID | 102435735 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 7-nitro-2,3,4,4a-tetrahydrothioxanthen-1-one |
| SMILES | O=C1CCCC2Sc3ccc([N+](=O)[O-])cc3C=C12 |
| InChI | InChI=1S/C13H11NO3S/c15-11-2-1-3-13-10(11)7-8-6-9(14(16)17)4-5-12(8)18-13/h4-7,13H,1-3H2 |
| InChIKey | VAKRFOLCKXAJFS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|