C12H9NO4 — CID 86032903
7-nitro-3,3a-dihydro-2H-cyclopenta[b]chromen-1-one (PubChem CID 86032903) has the molecular formula C12H9NO4 and a molecular weight of 231.21 g/mol. Its IUPAC name is 7-nitro-3,3a-dihydro-2H-cyclopenta[b]chromen-1-one.
| Compound Name | 7-nitro-3,3a-dihydro-2H-cyclopenta[b]chromen-1-one |
|---|---|
| PubChem CID | 86032903 |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 7-nitro-3,3a-dihydro-2H-cyclopenta[b]chromen-1-one |
| SMILES | O=C1CCC2Oc3ccc([N+](=O)[O-])cc3C=C12 |
| InChI | InChI=1S/C12H9NO4/c14-10-2-4-12-9(10)6-7-5-8(13(15)16)1-3-11(7)17-12/h1,3,5-6,12H,2,4H2 |
| InChIKey | IWHQSNFCGHIIPX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|