C21H26O2 — CID 102436390
(2R)-2-methyl-5,7-di(propan-2-yl)-1,2,3,4-tetrahydroanthracene-9,10-dione (PubChem CID 102436390) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (2R)-2-methyl-5,7-di(propan-2-yl)-1,2,3,4-tetrahydroanthracene-9,10-dione.
| Compound Name | (2R)-2-methyl-5,7-di(propan-2-yl)-1,2,3,4-tetrahydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 102436390 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (2R)-2-methyl-5,7-di(propan-2-yl)-1,2,3,4-tetrahydroanthracene-9,10-dione |
| SMILES | CC(C)c1cc2c(c(C(C)C)c1)C(=O)C1=C(C[C@H](C)CC1)C2=O |
| InChI | InChI=1S/C21H26O2/c1-11(2)14-9-16(12(3)4)19-18(10-14)20(22)17-8-13(5)6-7-15(17)21(19)23/h9-13H,6-8H2,1-5H3/t13-/m1/s1 |
| InChIKey | CUVGALNFVYWOOT-CYBMUJFWSA-N |
| XLogP | 5.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|