C24H32N2O2 — CID 137350371
N'-[4-formyl-2-methyl-5,7-di(propan-2-yl)-2,3-dihydro-1H-xanthen-9-yl]-N,N-dimethylmethanimidamide (PubChem CID 137350371) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is N'-[4-formyl-2-methyl-5,7-di(propan-2-yl)-2,3-dihydro-1H-xanthen-9-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-formyl-2-methyl-5,7-di(propan-2-yl)-2,3-dihydro-1H-xanthen-9-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 137350371 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | N'-[4-formyl-2-methyl-5,7-di(propan-2-yl)-2,3-dihydro-1H-xanthen-9-yl]-N,N-dimethylmethanimidamide |
| SMILES | CC1CC(C=O)=C2Oc3c(cc(C(C)C)cc3C(C)C)C(/N=C/N(C)C)=C2C1 |
| InChI | InChI=1S/C24H32N2O2/c1-14(2)17-10-19(15(3)4)24-21(11-17)22(25-13-26(6)7)20-9-16(5)8-18(12-27)23(20)28-24/h10-16H,8-9H2,1-7H3/b25-13+ |
| InChIKey | JBQLXBUECMIISU-DHRITJCHSA-N |
| XLogP | 5.51 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|