C16H9F26O4P — CID 102440291
bis(1,1,2,2-tetradeuterio-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) hydrogen phosphate (PubChem CID 102440291) has the molecular formula C16H9F26O4P and a molecular weight of 798.21 g/mol. Its IUPAC name is bis(1,1,2,2-tetradeuterio-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) hydrogen phosphate.
| Compound Name | bis(1,1,2,2-tetradeuterio-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) hydrogen phosphate |
|---|---|
| PubChem CID | 102440291 |
| Molecular Formula | C16H9F26O4P |
| Molecular Weight | 798.21 g/mol |
| Exact Mass | 798.03 |
| IUPAC Name | bis(1,1,2,2-tetradeuterio-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) hydrogen phosphate |
| SMILES | [2H]C([2H])(OP(=O)(O)OC([2H])([2H])C([2H])([2H])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C([2H])([2H])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H9F26O4P/c17-5(18,7(21,22)9(25,26)11(29,30)13(33,34)15(37,38)39)1-3-45-47(43,44)46-4-2-6(19,20)8(23,24)10(27,28)12(31,32)14(35,36)16(40,41)42/h1-4H2,(H,43,44)/i1D2,2D2,3D2,4D2 |
| InChIKey | ZDYYWMSLMLTXDM-SVYQBANQSA-N |
| XLogP | 9.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.21 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|