C20H19BrO3S2 — CID 102440420
butyl (2E,6E)-7-(4-bromophenyl)-4-(1,3-dithiol-2-ylidene)-5-oxohepta-2,6-dienoate (PubChem CID 102440420) has the molecular formula C20H19BrO3S2 and a molecular weight of 451.41 g/mol. Its IUPAC name is butyl (2E,6E)-7-(4-bromophenyl)-4-(1,3-dithiol-2-ylidene)-5-oxohepta-2,6-dienoate.
| Compound Name | butyl (2E,6E)-7-(4-bromophenyl)-4-(1,3-dithiol-2-ylidene)-5-oxohepta-2,6-dienoate |
|---|---|
| PubChem CID | 102440420 |
| Molecular Formula | C20H19BrO3S2 |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | butyl (2E,6E)-7-(4-bromophenyl)-4-(1,3-dithiol-2-ylidene)-5-oxohepta-2,6-dienoate |
| SMILES | CCCCOC(=O)/C=C/C(C(=O)/C=C/c1ccc(Br)cc1)=C1SC=CS1 |
| InChI | InChI=1S/C20H19BrO3S2/c1-2-3-12-24-19(23)11-9-17(20-25-13-14-26-20)18(22)10-6-15-4-7-16(21)8-5-15/h4-11,13-14H,2-3,12H2,1H3/b10-6+,11-9+ |
| InChIKey | VQMSHMAOFLMRKR-BBYAVRKXSA-N |
| XLogP | 6.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|