C69H66N2O14 — CID 102441481
bis[2-[(4-cyanophenyl)methoxycarbonyl]-4-(4-octoxybenzoyl)oxyphenyl] 2-methylbenzene-1,3-dicarboxylate (PubChem CID 102441481) has the molecular formula C69H66N2O14 and a molecular weight of 1147.29 g/mol. Its IUPAC name is bis[2-[(4-cyanophenyl)methoxycarbonyl]-4-(4-octoxybenzoyl)oxyphenyl] 2-methylbenzene-1,3-dicarboxylate.
| Compound Name | bis[2-[(4-cyanophenyl)methoxycarbonyl]-4-(4-octoxybenzoyl)oxyphenyl] 2-methylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 102441481 |
| Molecular Formula | C69H66N2O14 |
| Molecular Weight | 1147.29 g/mol |
| Exact Mass | 1146.45 |
| IUPAC Name | bis[2-[(4-cyanophenyl)methoxycarbonyl]-4-(4-octoxybenzoyl)oxyphenyl] 2-methylbenzene-1,3-dicarboxylate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3cccc(C(=O)Oc4ccc(OC(=O)c5ccc(OCCCCCCCC)cc5)cc4C(=O)OCc4ccc(C#N)cc4)c3C)c(C(=O)OCc3ccc(C#N)cc3)c2)cc1 |
| InChI | InChI=1S/C69H66N2O14/c1-4-6-8-10-12-14-39-78-54-31-27-52(28-32-54)64(72)82-56-35-37-62(60(41-56)66(74)80-45-50-23-19-48(43-70)20-24-50)84-68(76)58-17-16-18-59(47(58)3)69(77)85-63-38-36-57(42-61(63)67(75)81-46-51-25-21-49(44-71)22-26-51)83-65(73)53-29-33-55(34-30-53)79-40-15-13-11-9-7-5-2/h16-38,41-42H,4-15,39-40,45-46H2,1-3H3 |
| InChIKey | KRHBBSLGHVSKPC-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 223.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1147.29 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|