C28H29NO8 — CID 43833866
(4-nitrophenyl)methyl 5-(4-heptoxybenzoyl)oxy-2-hydroxybenzoate (PubChem CID 43833866) has the molecular formula C28H29NO8 and a molecular weight of 507.54 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 5-(4-heptoxybenzoyl)oxy-2-hydroxybenzoate.
| Compound Name | (4-nitrophenyl)methyl 5-(4-heptoxybenzoyl)oxy-2-hydroxybenzoate |
|---|---|
| PubChem CID | 43833866 |
| Molecular Formula | C28H29NO8 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | (4-nitrophenyl)methyl 5-(4-heptoxybenzoyl)oxy-2-hydroxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(O)c(C(=O)OCc3ccc([N+](=O)[O-])cc3)c2)cc1 |
| InChI | InChI=1S/C28H29NO8/c1-2-3-4-5-6-17-35-23-13-9-21(10-14-23)27(31)37-24-15-16-26(30)25(18-24)28(32)36-19-20-7-11-22(12-8-20)29(33)34/h7-16,18,30H,2-6,17,19H2,1H3 |
| InChIKey | MPRBZLYTNQNZKT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|