C18H17NO — CID 102443855
(1R)-1-methyl-1-phenyl-3,4-dihydro-[1,4]oxazino[4,3-a]indole (PubChem CID 102443855) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is (1R)-1-methyl-1-phenyl-3,4-dihydro-[1,4]oxazino[4,3-a]indole.
| Compound Name | (1R)-1-methyl-1-phenyl-3,4-dihydro-[1,4]oxazino[4,3-a]indole |
|---|---|
| PubChem CID | 102443855 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (1R)-1-methyl-1-phenyl-3,4-dihydro-[1,4]oxazino[4,3-a]indole |
| SMILES | C[C@]1(c2ccccc2)OCCn2c1cc1ccccc12 |
| InChI | InChI=1S/C18H17NO/c1-18(15-8-3-2-4-9-15)17-13-14-7-5-6-10-16(14)19(17)11-12-20-18/h2-10,13H,11-12H2,1H3/t18-/m1/s1 |
| InChIKey | AXJHOYSPSFCIAH-GOSISDBHSA-N |
| XLogP | 3.93 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |