C19H19NO — CID 139261397
1-methyl-1-phenyl-4,5-dihydro-3H-[1,4]oxazepino[4,3-a]indole (PubChem CID 139261397) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-methyl-1-phenyl-4,5-dihydro-3H-[1,4]oxazepino[4,3-a]indole.
| Compound Name | 1-methyl-1-phenyl-4,5-dihydro-3H-[1,4]oxazepino[4,3-a]indole |
|---|---|
| PubChem CID | 139261397 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-methyl-1-phenyl-4,5-dihydro-3H-[1,4]oxazepino[4,3-a]indole |
| SMILES | CC1(c2ccccc2)OCCCn2c1cc1ccccc12 |
| InChI | InChI=1S/C19H19NO/c1-19(16-9-3-2-4-10-16)18-14-15-8-5-6-11-17(15)20(18)12-7-13-21-19/h2-6,8-11,14H,7,12-13H2,1H3 |
| InChIKey | KJQOFTWMADKQEF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |