C15H13NS — CID 102444640
3-benzyl-2,3-dihydroisoindole-1-thione (PubChem CID 102444640) has the molecular formula C15H13NS and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-benzyl-2,3-dihydroisoindole-1-thione.
| Compound Name | 3-benzyl-2,3-dihydroisoindole-1-thione |
|---|---|
| PubChem CID | 102444640 |
| Molecular Formula | C15H13NS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-benzyl-2,3-dihydroisoindole-1-thione |
| SMILES | S=C1NC(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C15H13NS/c17-15-13-9-5-4-8-12(13)14(16-15)10-11-6-2-1-3-7-11/h1-9,14H,10H2,(H,16,17) |
| InChIKey | MKFGEAPSESEIHF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|