C27H22F4O4 — CID 102446375
(4-methoxyphenyl) 4-[2-[2,3,5,6-tetrafluoro-4-[(2S)-2-methylbutoxy]phenyl]ethynyl]benzoate (PubChem CID 102446375) has the molecular formula C27H22F4O4 and a molecular weight of 486.46 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-[2-[2,3,5,6-tetrafluoro-4-[(2S)-2-methylbutoxy]phenyl]ethynyl]benzoate.
| Compound Name | (4-methoxyphenyl) 4-[2-[2,3,5,6-tetrafluoro-4-[(2S)-2-methylbutoxy]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 102446375 |
| Molecular Formula | C27H22F4O4 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | (4-methoxyphenyl) 4-[2-[2,3,5,6-tetrafluoro-4-[(2S)-2-methylbutoxy]phenyl]ethynyl]benzoate |
| SMILES | CC[C@H](C)COc1c(F)c(F)c(C#Cc2ccc(C(=O)Oc3ccc(OC)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C27H22F4O4/c1-4-16(2)15-34-26-24(30)22(28)21(23(29)25(26)31)14-7-17-5-8-18(9-6-17)27(32)35-20-12-10-19(33-3)11-13-20/h5-6,8-13,16H,4,15H2,1-3H3/t16-/m0/s1 |
| InChIKey | QHTWASCHHITKLE-INIZCTEOSA-N |
| XLogP | 6.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|