C25H42O4Si — CID 102448858
1-[(1S,2R,3S,8R,10Z,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-ethoxy-10-methyl-15-oxatricyclo[6.6.1.02,7]pentadeca-6,10-dien-3-yl]ethanone (PubChem CID 102448858) has the molecular formula C25H42O4Si and a molecular weight of 434.69 g/mol. Its IUPAC name is 1-[(1S,2R,3S,8R,10Z,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-ethoxy-10-methyl-15-oxatricyclo[6.6.1.02,7]pentadeca-6,10-dien-3-yl]ethanone.
| Compound Name | 1-[(1S,2R,3S,8R,10Z,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-ethoxy-10-methyl-15-oxatricyclo[6.6.1.02,7]pentadeca-6,10-dien-3-yl]ethanone |
|---|---|
| PubChem CID | 102448858 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 1-[(1S,2R,3S,8R,10Z,14S)-14-[tert-butyl(dimethyl)silyl]oxy-6-ethoxy-10-methyl-15-oxatricyclo[6.6.1.02,7]pentadeca-6,10-dien-3-yl]ethanone |
| SMILES | CCOC1=C2[C@H]([C@@H]3O[C@@H]2C/C(C)=C\CC[C@@H]3O[Si](C)(C)C(C)(C)C)[C@@H](C(C)=O)CC1 |
| InChI | InChI=1S/C25H42O4Si/c1-9-27-19-14-13-18(17(3)26)22-23(19)21-15-16(2)11-10-12-20(24(22)28-21)29-30(7,8)25(4,5)6/h11,18,20-22,24H,9-10,12-15H2,1-8H3/b16-11-/t18-,20+,21-,22-,24-/m1/s1 |
| InChIKey | FWHDCCRGNFDBGC-UAAKYFIWSA-N |
| XLogP | 6.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|