C21H18N6 — CID 102450361
N,N,N',N'-tetrapyridin-4-ylmethanediamine (PubChem CID 102450361) has the molecular formula C21H18N6 and a molecular weight of 354.42 g/mol. Its IUPAC name is N,N,N',N'-tetrapyridin-4-ylmethanediamine.
| Compound Name | N,N,N',N'-tetrapyridin-4-ylmethanediamine |
|---|---|
| PubChem CID | 102450361 |
| Molecular Formula | C21H18N6 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N,N,N',N'-tetrapyridin-4-ylmethanediamine |
| SMILES | c1cc(N(CN(c2ccncc2)c2ccncc2)c2ccncc2)ccn1 |
| InChI | InChI=1S/C21H18N6/c1-9-22-10-2-18(1)26(19-3-11-23-12-4-19)17-27(20-5-13-24-14-6-20)21-7-15-25-16-8-21/h1-16H,17H2 |
| InChIKey | RRWSGOMJPMNLEP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|