C16H21NO6S — CID 102450734
diethyl 1-(4-methylphenyl)sulfonylazetidine-2,2-dicarboxylate (PubChem CID 102450734) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is diethyl 1-(4-methylphenyl)sulfonylazetidine-2,2-dicarboxylate.
| Compound Name | diethyl 1-(4-methylphenyl)sulfonylazetidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102450734 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | diethyl 1-(4-methylphenyl)sulfonylazetidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H21NO6S/c1-4-22-14(18)16(15(19)23-5-2)10-11-17(16)24(20,21)13-8-6-12(3)7-9-13/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | ADPNKYKBFNIJEZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|