C16H29NO3SSi — CID 102451474
[(4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-2,2-dimethyl-1,3-dioxan-5-yl] thiocyanate (PubChem CID 102451474) has the molecular formula C16H29NO3SSi and a molecular weight of 343.57 g/mol. Its IUPAC name is [(4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-2,2-dimethyl-1,3-dioxan-5-yl] thiocyanate.
| Compound Name | [(4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-2,2-dimethyl-1,3-dioxan-5-yl] thiocyanate |
|---|---|
| PubChem CID | 102451474 |
| Molecular Formula | C16H29NO3SSi |
| Molecular Weight | 343.57 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [(4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-2,2-dimethyl-1,3-dioxan-5-yl] thiocyanate |
| SMILES | C=C[C@@]1(SC#N)COC(C)(C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H29NO3SSi/c1-9-16(21-12-17)11-18-15(5,6)20-13(16)10-19-22(7,8)14(2,3)4/h9,13H,1,10-11H2,2-8H3/t13-,16-/m1/s1 |
| InChIKey | JPLDYOQDVARFJP-CZUORRHYSA-N |
| XLogP | 4.30 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|