C14H23NO2S — CID 102452972
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-isothiocyanatopropanoate (PubChem CID 102452972) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-isothiocyanatopropanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-isothiocyanatopropanoate |
|---|---|
| PubChem CID | 102452972 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-isothiocyanatopropanoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)[C@H](C)N=C=S |
| InChI | InChI=1S/C14H23NO2S/c1-9(2)12-6-5-10(3)7-13(12)17-14(16)11(4)15-8-18/h9-13H,5-7H2,1-4H3/t10-,11+,12+,13-/m1/s1 |
| InChIKey | FLFZZOPIUSCUHG-MROQNXINSA-N |
| XLogP | 3.48 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|