C22H18O4S3 — CID 102455089
5-[5-[5-(2,4,6-trimethoxyphenyl)thiophen-2-yl]thiophen-2-yl]thiophene-2-carbaldehyde (PubChem CID 102455089) has the molecular formula C22H18O4S3 and a molecular weight of 442.58 g/mol. Its IUPAC name is 5-[5-[5-(2,4,6-trimethoxyphenyl)thiophen-2-yl]thiophen-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[5-[5-(2,4,6-trimethoxyphenyl)thiophen-2-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 102455089 |
| Molecular Formula | C22H18O4S3 |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 5-[5-[5-(2,4,6-trimethoxyphenyl)thiophen-2-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
| SMILES | COc1cc(OC)c(-c2ccc(-c3ccc(-c4ccc(C=O)s4)s3)s2)c(OC)c1 |
| InChI | InChI=1S/C22H18O4S3/c1-24-13-10-15(25-2)22(16(11-13)26-3)21-9-8-20(29-21)19-7-6-18(28-19)17-5-4-14(12-23)27-17/h4-12H,1-3H3 |
| InChIKey | BACJFDHIZDOSHV-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|