C14H20N4O2S — CID 102456167
1,3,6,8-tetramethyl-8a-thiophen-2-yl-4a,5-dihydro-4H-pyrimido[4,5-d]pyrimidine-2,7-dione (PubChem CID 102456167) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 1,3,6,8-tetramethyl-8a-thiophen-2-yl-4a,5-dihydro-4H-pyrimido[4,5-d]pyrimidine-2,7-dione.
| Compound Name | 1,3,6,8-tetramethyl-8a-thiophen-2-yl-4a,5-dihydro-4H-pyrimido[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 102456167 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1,3,6,8-tetramethyl-8a-thiophen-2-yl-4a,5-dihydro-4H-pyrimido[4,5-d]pyrimidine-2,7-dione |
| SMILES | CN1CC2CN(C)C(=O)N(C)C2(c2cccs2)N(C)C1=O |
| InChI | InChI=1S/C14H20N4O2S/c1-15-8-10-9-16(2)13(20)18(4)14(10,17(3)12(15)19)11-6-5-7-21-11/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | ZJQFITAMQFNCAV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |