C9H12N2OS — CID 129451305
(3R,4S)-3-amino-1,4-dimethyl-4-thiophen-2-ylazetidin-2-one (PubChem CID 129451305) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is (3R,4S)-3-amino-1,4-dimethyl-4-thiophen-2-ylazetidin-2-one.
| Compound Name | (3R,4S)-3-amino-1,4-dimethyl-4-thiophen-2-ylazetidin-2-one |
|---|---|
| PubChem CID | 129451305 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3R,4S)-3-amino-1,4-dimethyl-4-thiophen-2-ylazetidin-2-one |
| SMILES | CN1C(=O)[C@H](N)[C@@]1(C)c1cccs1 |
| InChI | InChI=1S/C9H12N2OS/c1-9(6-4-3-5-13-6)7(10)8(12)11(9)2/h3-5,7H,10H2,1-2H3/t7-,9+/m0/s1 |
| InChIKey | JLFQTLDGYDZUEU-IONNQARKSA-N |
| XLogP | 0.76 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |