C20H26I2N2O4 — CID 102456999
tert-butyl N-[(1R)-2-(hepta-1,6-dien-4-ylamino)-1-(4-hydroxy-3,5-diiodophenyl)-2-oxoethyl]carbamate (PubChem CID 102456999) has the molecular formula C20H26I2N2O4 and a molecular weight of 612.25 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-(hepta-1,6-dien-4-ylamino)-1-(4-hydroxy-3,5-diiodophenyl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-(hepta-1,6-dien-4-ylamino)-1-(4-hydroxy-3,5-diiodophenyl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 102456999 |
| Molecular Formula | C20H26I2N2O4 |
| Molecular Weight | 612.25 g/mol |
| Exact Mass | 612.00 |
| IUPAC Name | tert-butyl N-[(1R)-2-(hepta-1,6-dien-4-ylamino)-1-(4-hydroxy-3,5-diiodophenyl)-2-oxoethyl]carbamate |
| SMILES | C=CCC(CC=C)NC(=O)[C@H](NC(=O)OC(C)(C)C)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C20H26I2N2O4/c1-6-8-13(9-7-2)23-18(26)16(24-19(27)28-20(3,4)5)12-10-14(21)17(25)15(22)11-12/h6-7,10-11,13,16,25H,1-2,8-9H2,3-5H3,(H,23,26)(H,24,27)/t16-/m1/s1 |
| InChIKey | PWHPBIKSCHXYPQ-MRXNPFEDSA-N |
| XLogP | 4.80 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.25 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|