C24H19N3O3S — CID 102460276
(1aR,2S,7bS)-3-benzoyl-1-(4-methylphenyl)sulfonyl-2,7b-dihydro-1aH-azirino[2,3-c]quinoline-2-carbonitrile (PubChem CID 102460276) has the molecular formula C24H19N3O3S and a molecular weight of 429.50 g/mol. Its IUPAC name is (1aR,2S,7bS)-3-benzoyl-1-(4-methylphenyl)sulfonyl-2,7b-dihydro-1aH-azirino[2,3-c]quinoline-2-carbonitrile.
| Compound Name | (1aR,2S,7bS)-3-benzoyl-1-(4-methylphenyl)sulfonyl-2,7b-dihydro-1aH-azirino[2,3-c]quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 102460276 |
| Molecular Formula | C24H19N3O3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (1aR,2S,7bS)-3-benzoyl-1-(4-methylphenyl)sulfonyl-2,7b-dihydro-1aH-azirino[2,3-c]quinoline-2-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H]3[C@@H](C#N)N(C(=O)c4ccccc4)c4ccccc4[C@@H]32)cc1 |
| InChI | InChI=1S/C24H19N3O3S/c1-16-11-13-18(14-12-16)31(29,30)27-22-19-9-5-6-10-20(19)26(21(15-25)23(22)27)24(28)17-7-3-2-4-8-17/h2-14,21-23H,1H3/t21-,22+,23-,27?/m1/s1 |
| InChIKey | ULHKQHZDTRHNBD-UXWJYDTRSA-N |
| XLogP | 3.66 |
| TPSA | 81.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|