C17H13BrN2O2 — CID 7203511
(2R,3R,4R)-1-benzoyl-3-bromo-4-hydroxy-3,4-dihydro-2H-quinoline-2-carbonitrile (PubChem CID 7203511) has the molecular formula C17H13BrN2O2 and a molecular weight of 357.21 g/mol. Its IUPAC name is (2R,3R,4R)-1-benzoyl-3-bromo-4-hydroxy-3,4-dihydro-2H-quinoline-2-carbonitrile.
| Compound Name | (2R,3R,4R)-1-benzoyl-3-bromo-4-hydroxy-3,4-dihydro-2H-quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 7203511 |
| Molecular Formula | C17H13BrN2O2 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | (2R,3R,4R)-1-benzoyl-3-bromo-4-hydroxy-3,4-dihydro-2H-quinoline-2-carbonitrile |
| SMILES | N#C[C@@H]1[C@@H](Br)[C@H](O)c2ccccc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H13BrN2O2/c18-15-14(10-19)20(17(22)11-6-2-1-3-7-11)13-9-5-4-8-12(13)16(15)21/h1-9,14-16,21H/t14-,15-,16-/m1/s1 |
| InChIKey | PKNLRSBYSSNFHC-BZUAXINKSA-N |
| XLogP | 3.04 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|