C18H13Br2NO — CID 124932522
(1S,2S,3S,4R)-1-benzoyl-3,4-dibromo-1,2,3,4-tetrahydronaphthalene-2-carbonitrile (PubChem CID 124932522) has the molecular formula C18H13Br2NO and a molecular weight of 419.12 g/mol. Its IUPAC name is (1S,2S,3S,4R)-1-benzoyl-3,4-dibromo-1,2,3,4-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | (1S,2S,3S,4R)-1-benzoyl-3,4-dibromo-1,2,3,4-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 124932522 |
| Molecular Formula | C18H13Br2NO |
| Molecular Weight | 419.12 g/mol |
| Exact Mass | 416.94 |
| IUPAC Name | (1S,2S,3S,4R)-1-benzoyl-3,4-dibromo-1,2,3,4-tetrahydronaphthalene-2-carbonitrile |
| SMILES | N#C[C@H]1[C@H](Br)[C@H](Br)c2ccccc2[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H13Br2NO/c19-16-13-9-5-4-8-12(13)15(14(10-21)17(16)20)18(22)11-6-2-1-3-7-11/h1-9,14-17H/t14-,15-,16-,17+/m1/s1 |
| InChIKey | OUUVCVLNYJJKPE-VQHPVUNQSA-N |
| XLogP | 5.01 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.12 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|