C14H7N3O3 — CID 98083117
(1R,5R)-6-benzoyl-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile (PubChem CID 98083117) has the molecular formula C14H7N3O3 and a molecular weight of 265.23 g/mol. Its IUPAC name is (1R,5R)-6-benzoyl-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile.
| Compound Name | (1R,5R)-6-benzoyl-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 98083117 |
| Molecular Formula | C14H7N3O3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | (1R,5R)-6-benzoyl-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile |
| SMILES | N#C[C@]12C(=O)NC(=O)[C@]1(C#N)C2C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H7N3O3/c15-6-13-10(9(18)8-4-2-1-3-5-8)14(13,7-16)12(20)17-11(13)19/h1-5,10H,(H,17,19,20)/t13-,14-/m0/s1 |
| InChIKey | MNHCXUORFGREIR-KBPBESRZSA-N |
| XLogP | 0.18 |
| TPSA | 110.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|