C18H13NO2 — CID 98104086
(2R,5R)-2-benzoyl-5-phenyl-2H-furan-5-carbonitrile (PubChem CID 98104086) has the molecular formula C18H13NO2 and a molecular weight of 275.31 g/mol. Its IUPAC name is (2R,5R)-2-benzoyl-5-phenyl-2H-furan-5-carbonitrile.
| Compound Name | (2R,5R)-2-benzoyl-5-phenyl-2H-furan-5-carbonitrile |
|---|---|
| PubChem CID | 98104086 |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (2R,5R)-2-benzoyl-5-phenyl-2H-furan-5-carbonitrile |
| SMILES | N#C[C@]1(c2ccccc2)C=C[C@H](C(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C18H13NO2/c19-13-18(15-9-5-2-6-10-15)12-11-16(21-18)17(20)14-7-3-1-4-8-14/h1-12,16H/t16-,18+/m1/s1 |
| InChIKey | ZIRIECLYIZAGCL-AEFFLSMTSA-N |
| XLogP | 3.24 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|