C12H11NO2S — CID 121013931
(2-methyl-1,3-dioxo-1-phenylbutan-2-yl) thiocyanate (PubChem CID 121013931) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is (2-methyl-1,3-dioxo-1-phenylbutan-2-yl) thiocyanate.
| Compound Name | (2-methyl-1,3-dioxo-1-phenylbutan-2-yl) thiocyanate |
|---|---|
| PubChem CID | 121013931 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | (2-methyl-1,3-dioxo-1-phenylbutan-2-yl) thiocyanate |
| SMILES | CC(=O)C(C)(SC#N)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H11NO2S/c1-9(14)12(2,16-8-13)11(15)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | HMWGDRUMLOOZGJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|