C23H25Cl2N3OS — CID 102461842
2-(3,4-dichlorophenyl)-N-[(2S)-1-(3-isothiocyanatophenyl)-3-pyrrolidin-1-ylpropan-2-yl]-N-methylacetamide (PubChem CID 102461842) has the molecular formula C23H25Cl2N3OS and a molecular weight of 462.45 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[(2S)-1-(3-isothiocyanatophenyl)-3-pyrrolidin-1-ylpropan-2-yl]-N-methylacetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[(2S)-1-(3-isothiocyanatophenyl)-3-pyrrolidin-1-ylpropan-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 102461842 |
| Molecular Formula | C23H25Cl2N3OS |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[(2S)-1-(3-isothiocyanatophenyl)-3-pyrrolidin-1-ylpropan-2-yl]-N-methylacetamide |
| SMILES | CN(C(=O)Cc1ccc(Cl)c(Cl)c1)[C@@H](Cc1cccc(N=C=S)c1)CN1CCCC1 |
| InChI | InChI=1S/C23H25Cl2N3OS/c1-27(23(29)14-18-7-8-21(24)22(25)13-18)20(15-28-9-2-3-10-28)12-17-5-4-6-19(11-17)26-16-30/h4-8,11,13,20H,2-3,9-10,12,14-15H2,1H3/t20-/m0/s1 |
| InChIKey | CJIYKMFJLWUKOZ-FQEVSTJZSA-N |
| XLogP | 5.44 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|