C43H25Cl2S6+ — CID 102462682
2-[bis(4-chlorophenyl)methyl]-5-[[2,3-bis(dithiophen-2-ylmethylidene)cyclopropylidene]-thiophen-2-ylmethyl]thiophene (PubChem CID 102462682) has the molecular formula C43H25Cl2S6+ and a molecular weight of 804.98 g/mol. Its IUPAC name is 2-[bis(4-chlorophenyl)methyl]-5-[[2,3-bis(dithiophen-2-ylmethylidene)cyclopropylidene]-thiophen-2-ylmethyl]thiophene.
| Compound Name | 2-[bis(4-chlorophenyl)methyl]-5-[[2,3-bis(dithiophen-2-ylmethylidene)cyclopropylidene]-thiophen-2-ylmethyl]thiophene |
|---|---|
| PubChem CID | 102462682 |
| Molecular Formula | C43H25Cl2S6+ |
| Molecular Weight | 804.98 g/mol |
| Exact Mass | 802.97 |
| IUPAC Name | 2-[bis(4-chlorophenyl)methyl]-5-[[2,3-bis(dithiophen-2-ylmethylidene)cyclopropylidene]-thiophen-2-ylmethyl]thiophene |
| SMILES | Clc1ccc([C+](c2ccc(Cl)cc2)c2ccc(C(=C3C(=C(c4cccs4)c4cccs4)C3=C(c3cccs3)c3cccs3)c3cccs3)s2)cc1 |
| InChI | InChI=1S/C43H25Cl2S6/c44-28-15-11-26(12-16-28)37(27-13-17-29(45)18-14-27)35-19-20-36(51-35)40(34-10-5-25-50-34)43-41(38(30-6-1-21-46-30)31-7-2-22-47-31)42(43)39(32-8-3-23-48-32)33-9-4-24-49-33/h1-25H/q+1 |
| InChIKey | ADJSMEXJNDCGFK-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.98 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|