C24H11N3O2S2 — CID 102471266
5-[5-(6,11-dioxo-3H-naphtho[2,3-e]benzimidazol-2-yl)thiophen-2-yl]thiophene-2-carbonitrile (PubChem CID 102471266) has the molecular formula C24H11N3O2S2 and a molecular weight of 437.51 g/mol. Its IUPAC name is 5-[5-(6,11-dioxo-3H-naphtho[2,3-e]benzimidazol-2-yl)thiophen-2-yl]thiophene-2-carbonitrile.
| Compound Name | 5-[5-(6,11-dioxo-3H-naphtho[2,3-e]benzimidazol-2-yl)thiophen-2-yl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 102471266 |
| Molecular Formula | C24H11N3O2S2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 5-[5-(6,11-dioxo-3H-naphtho[2,3-e]benzimidazol-2-yl)thiophen-2-yl]thiophene-2-carbonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3nc4c5c(ccc4[nH]3)C(=O)c3ccccc3C5=O)s2)s1 |
| InChI | InChI=1S/C24H11N3O2S2/c25-11-12-5-8-17(30-12)18-9-10-19(31-18)24-26-16-7-6-15-20(21(16)27-24)23(29)14-4-2-1-3-13(14)22(15)28/h1-10H,(H,26,27) |
| InChIKey | GHWSCYGGORTQAZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|