C34H28N4O5 — CID 158131860
1,2-diaminoanthracene-9,10-dione;2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione;propanal (PubChem CID 158131860) has the molecular formula C34H28N4O5 and a molecular weight of 572.62 g/mol. Its IUPAC name is 1,2-diaminoanthracene-9,10-dione;2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione;propanal.
| Compound Name | 1,2-diaminoanthracene-9,10-dione;2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione;propanal |
|---|---|
| PubChem CID | 158131860 |
| Molecular Formula | C34H28N4O5 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 1,2-diaminoanthracene-9,10-dione;2-ethyl-3H-naphtho[3,2-e]benzimidazole-6,11-dione;propanal |
| SMILES | CCC=O.CCc1nc2c3c(ccc2[nH]1)C(=O)c1ccccc1C3=O.Nc1ccc2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H12N2O2.C14H10N2O2.C3H6O/c1-2-13-18-12-8-7-11-14(15(12)19-13)17(21)10-6-4-3-5-9(10)16(11)20;15-10-6-5-9-11(12(10)16)14(18)8-4-2-1-3-7(8)13(9)17;1-2-3-4/h3-8H,2H2,1H3,(H,18,19);1-6H,15-16H2;3H,2H2,1H3 |
| InChIKey | FSWIUZJTVZBEFF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 166.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|