C30H18N4O4S3 — CID 169431484
1,2-diaminoanthracene-9,10-dione;methanedithione;2-sulfanylidene-1,3-dihydronaphtho[3,2-e]benzimidazole-6,11-dione (PubChem CID 169431484) has the molecular formula C30H18N4O4S3 and a molecular weight of 594.70 g/mol. Its IUPAC name is 1,2-diaminoanthracene-9,10-dione;methanedithione;2-sulfanylidene-1,3-dihydronaphtho[3,2-e]benzimidazole-6,11-dione.
| Compound Name | 1,2-diaminoanthracene-9,10-dione;methanedithione;2-sulfanylidene-1,3-dihydronaphtho[3,2-e]benzimidazole-6,11-dione |
|---|---|
| PubChem CID | 169431484 |
| Molecular Formula | C30H18N4O4S3 |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.05 |
| IUPAC Name | 1,2-diaminoanthracene-9,10-dione;methanedithione;2-sulfanylidene-1,3-dihydronaphtho[3,2-e]benzimidazole-6,11-dione |
| SMILES | Nc1ccc2c(c1N)C(=O)c1ccccc1C2=O.O=C1c2ccccc2C(=O)c2c1ccc1[nH]c(=S)[nH]c21.S=C=S |
| InChI | InChI=1S/C15H8N2O2S.C14H10N2O2.CS2/c18-13-7-3-1-2-4-8(7)14(19)11-9(13)5-6-10-12(11)17-15(20)16-10;15-10-6-5-9-11(12(10)16)14(18)8-4-2-1-3-7(8)13(9)17;2-1-3/h1-6H,(H2,16,17,20);1-6H,15-16H2; |
| InChIKey | XXYMERFVULGPQT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 151.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|