C44H28N4O9 — CID 161100297
1,3-benzodioxole-5-carbaldehyde;2-(1,3-benzodioxol-5-yl)-3H-naphtho[3,2-e]benzimidazole-6,11-dione;1,2-diaminoanthracene-9,10-dione (PubChem CID 161100297) has the molecular formula C44H28N4O9 and a molecular weight of 756.73 g/mol. Its IUPAC name is 1,3-benzodioxole-5-carbaldehyde;2-(1,3-benzodioxol-5-yl)-3H-naphtho[3,2-e]benzimidazole-6,11-dione;1,2-diaminoanthracene-9,10-dione.
| Compound Name | 1,3-benzodioxole-5-carbaldehyde;2-(1,3-benzodioxol-5-yl)-3H-naphtho[3,2-e]benzimidazole-6,11-dione;1,2-diaminoanthracene-9,10-dione |
|---|---|
| PubChem CID | 161100297 |
| Molecular Formula | C44H28N4O9 |
| Molecular Weight | 756.73 g/mol |
| Exact Mass | 756.19 |
| IUPAC Name | 1,3-benzodioxole-5-carbaldehyde;2-(1,3-benzodioxol-5-yl)-3H-naphtho[3,2-e]benzimidazole-6,11-dione;1,2-diaminoanthracene-9,10-dione |
| SMILES | Nc1ccc2c(c1N)C(=O)c1ccccc1C2=O.O=C1c2ccccc2C(=O)c2c1ccc1[nH]c(-c3ccc4c(c3)OCO4)nc21.O=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H12N2O4.C14H10N2O2.C8H6O3/c25-20-12-3-1-2-4-13(12)21(26)18-14(20)6-7-15-19(18)24-22(23-15)11-5-8-16-17(9-11)28-10-27-16;15-10-6-5-9-11(12(10)16)14(18)8-4-2-1-3-7(8)13(9)17;9-4-6-1-2-7-8(3-6)11-5-10-7/h1-9H,10H2,(H,23,24);1-6H,15-16H2;1-4H,5H2 |
| InChIKey | UIIHAIYZRJKZSV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 202.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.73 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|