C18H15N3O3 — CID 10496003
2-[(2-hydroxyethylamino)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione (PubChem CID 10496003) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-[(2-hydroxyethylamino)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
| Compound Name | 2-[(2-hydroxyethylamino)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
|---|---|
| PubChem CID | 10496003 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-[(2-hydroxyethylamino)methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1[nH]c(CNCCO)nc21 |
| InChI | InChI=1S/C18H15N3O3/c22-8-7-19-9-14-20-13-6-5-12-15(16(13)21-14)18(24)11-4-2-1-3-10(11)17(12)23/h1-6,19,22H,7-9H2,(H,20,21) |
| InChIKey | MKPITDAXFBBDSE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|