C24H16F3N3O2 — CID 53372105
2-[[[3-(trifluoromethyl)phenyl]methylamino]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione (PubChem CID 53372105) has the molecular formula C24H16F3N3O2 and a molecular weight of 435.41 g/mol. Its IUPAC name is 2-[[[3-(trifluoromethyl)phenyl]methylamino]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
| Compound Name | 2-[[[3-(trifluoromethyl)phenyl]methylamino]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
|---|---|
| PubChem CID | 53372105 |
| Molecular Formula | C24H16F3N3O2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 2-[[[3-(trifluoromethyl)phenyl]methylamino]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1[nH]c(CNCc3cccc(C(F)(F)F)c3)nc21 |
| InChI | InChI=1S/C24H16F3N3O2/c25-24(26,27)14-5-3-4-13(10-14)11-28-12-19-29-18-9-8-17-20(21(18)30-19)23(32)16-7-2-1-6-15(16)22(17)31/h1-10,28H,11-12H2,(H,29,30) |
| InChIKey | RFSBHEXPYAGUHY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|