C22H16F3N3O — CID 4029329
3-[2-[[3-(trifluoromethyl)phenyl]methylamino]phenyl]-1H-quinoxalin-2-one (PubChem CID 4029329) has the molecular formula C22H16F3N3O and a molecular weight of 395.38 g/mol. Its IUPAC name is 3-[2-[[3-(trifluoromethyl)phenyl]methylamino]phenyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[2-[[3-(trifluoromethyl)phenyl]methylamino]phenyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 4029329 |
| Molecular Formula | C22H16F3N3O |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-[2-[[3-(trifluoromethyl)phenyl]methylamino]phenyl]-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2ccccc2nc1-c1ccccc1NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16F3N3O/c23-22(24,25)15-7-5-6-14(12-15)13-26-17-9-2-1-8-16(17)20-21(29)28-19-11-4-3-10-18(19)27-20/h1-12,26H,13H2,(H,28,29) |
| InChIKey | WCSOCIOUYJQTBD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |