C13H16OSe — CID 102472359
[(2Z)-1-methoxyhexa-2,5-dien-2-yl]selanylbenzene (PubChem CID 102472359) has the molecular formula C13H16OSe and a molecular weight of 267.23 g/mol. Its IUPAC name is [(2Z)-1-methoxyhexa-2,5-dien-2-yl]selanylbenzene.
| Compound Name | [(2Z)-1-methoxyhexa-2,5-dien-2-yl]selanylbenzene |
|---|---|
| PubChem CID | 102472359 |
| Molecular Formula | C13H16OSe |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | [(2Z)-1-methoxyhexa-2,5-dien-2-yl]selanylbenzene |
| SMILES | C=CC/C=C(/COC)[Se]c1ccccc1 |
| InChI | InChI=1S/C13H16OSe/c1-3-4-8-13(11-14-2)15-12-9-6-5-7-10-12/h3,5-10H,1,4,11H2,2H3/b13-8- |
| InChIKey | MJKAOIZWJWYPAW-JYRVWZFOSA-N |
| XLogP | 2.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|