C17H16Se — CID 102274955
[(1E,3Z)-1-phenylpenta-1,3-dien-3-yl]selanylbenzene (PubChem CID 102274955) has the molecular formula C17H16Se and a molecular weight of 299.28 g/mol. Its IUPAC name is [(1E,3Z)-1-phenylpenta-1,3-dien-3-yl]selanylbenzene.
| Compound Name | [(1E,3Z)-1-phenylpenta-1,3-dien-3-yl]selanylbenzene |
|---|---|
| PubChem CID | 102274955 |
| Molecular Formula | C17H16Se |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | [(1E,3Z)-1-phenylpenta-1,3-dien-3-yl]selanylbenzene |
| SMILES | C/C=C(/C=C/c1ccccc1)[Se]c1ccccc1 |
| InChI | InChI=1S/C17H16Se/c1-2-16(18-17-11-7-4-8-12-17)14-13-15-9-5-3-6-10-15/h2-14H,1H3/b14-13+,16-2- |
| InChIKey | GSQSUOHNJPPIRQ-JAHPZBGRSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|