C21H18Se2 — CID 102573736
[(Z)-2,3-bis(phenylselanyl)prop-1-enyl]benzene (PubChem CID 102573736) has the molecular formula C21H18Se2 and a molecular weight of 428.30 g/mol. Its IUPAC name is [(Z)-2,3-bis(phenylselanyl)prop-1-enyl]benzene.
| Compound Name | [(Z)-2,3-bis(phenylselanyl)prop-1-enyl]benzene |
|---|---|
| PubChem CID | 102573736 |
| Molecular Formula | C21H18Se2 |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | [(Z)-2,3-bis(phenylselanyl)prop-1-enyl]benzene |
| SMILES | C(=C(/C[Se]c1ccccc1)[Se]c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C21H18Se2/c1-4-10-18(11-5-1)16-21(23-20-14-8-3-9-15-20)17-22-19-12-6-2-7-13-19/h1-16H,17H2/b21-16- |
| InChIKey | MYAUVZFMOANXRY-PGMHBOJBSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|