C31H39NO4 — CID 102478777
(2R)-2-[[3-[[[4-(1-adamantyl)benzoyl]amino]methyl]-4-ethoxyphenyl]methyl]butanoic acid (PubChem CID 102478777) has the molecular formula C31H39NO4 and a molecular weight of 489.66 g/mol. Its IUPAC name is (2R)-2-[[3-[[[4-(1-adamantyl)benzoyl]amino]methyl]-4-ethoxyphenyl]methyl]butanoic acid.
| Compound Name | (2R)-2-[[3-[[[4-(1-adamantyl)benzoyl]amino]methyl]-4-ethoxyphenyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 102478777 |
| Molecular Formula | C31H39NO4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | (2R)-2-[[3-[[[4-(1-adamantyl)benzoyl]amino]methyl]-4-ethoxyphenyl]methyl]butanoic acid |
| SMILES | CCOc1ccc(C[C@@H](CC)C(=O)O)cc1CNC(=O)c1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C31H39NO4/c1-3-24(30(34)35)14-20-5-10-28(36-4-2)26(15-20)19-32-29(33)25-6-8-27(9-7-25)31-16-21-11-22(17-31)13-23(12-21)18-31/h5-10,15,21-24H,3-4,11-14,16-19H2,1-2H3,(H,32,33)(H,34,35)/t21?,22?,23?,24-,31?/m1/s1 |
| InChIKey | CGKNAWYMNWZFFL-LDJDCKKRSA-N |
| XLogP | 6.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |