C33H43NO4 — CID 46935844
(2S)-2-[[3-[[[4-(1-adamantyl)benzoyl]amino]methyl]-4-butoxyphenyl]methyl]butanoic acid (PubChem CID 46935844) has the molecular formula C33H43NO4 and a molecular weight of 517.71 g/mol. Its IUPAC name is (2S)-2-[[3-[[[4-(1-adamantyl)benzoyl]amino]methyl]-4-butoxyphenyl]methyl]butanoic acid.
| Compound Name | (2S)-2-[[3-[[[4-(1-adamantyl)benzoyl]amino]methyl]-4-butoxyphenyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 46935844 |
| Molecular Formula | C33H43NO4 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | (2S)-2-[[3-[[[4-(1-adamantyl)benzoyl]amino]methyl]-4-butoxyphenyl]methyl]butanoic acid |
| SMILES | CCCCOc1ccc(C[C@H](CC)C(=O)O)cc1CNC(=O)c1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C33H43NO4/c1-3-5-12-38-30-11-6-22(16-26(4-2)32(36)37)17-28(30)21-34-31(35)27-7-9-29(10-8-27)33-18-23-13-24(19-33)15-25(14-23)20-33/h6-11,17,23-26H,3-5,12-16,18-21H2,1-2H3,(H,34,35)(H,36,37)/t23?,24?,25?,26-,33?/m0/s1 |
| InChIKey | DEFUFGZNKMSDHW-XIJSUJFLSA-N |
| XLogP | 6.92 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|