C13H15N5OS — CID 102480761
ethyl N-(6-cyano-2,3-dimethyl-7-methylsulfanylimidazo[4,5-b]pyridin-5-yl)methanimidate (PubChem CID 102480761) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is ethyl N-(6-cyano-2,3-dimethyl-7-methylsulfanylimidazo[4,5-b]pyridin-5-yl)methanimidate.
| Compound Name | ethyl N-(6-cyano-2,3-dimethyl-7-methylsulfanylimidazo[4,5-b]pyridin-5-yl)methanimidate |
|---|---|
| PubChem CID | 102480761 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | ethyl N-(6-cyano-2,3-dimethyl-7-methylsulfanylimidazo[4,5-b]pyridin-5-yl)methanimidate |
| SMILES | CCO/C=N/c1nc2c(nc(C)n2C)c(SC)c1C#N |
| InChI | InChI=1S/C13H15N5OS/c1-5-19-7-15-12-9(6-14)11(20-4)10-13(17-12)18(3)8(2)16-10/h7H,5H2,1-4H3/b15-7+ |
| InChIKey | MECGTBQLLNDYMW-VIZOYTHASA-N |
| XLogP | 2.57 |
| TPSA | 76.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|