C9H7BrN4O — CID 11119036
ethyl (1E)-N-(5-bromo-3,4-dicyano-1H-pyrrol-2-yl)methanimidate (PubChem CID 11119036) has the molecular formula C9H7BrN4O and a molecular weight of 267.09 g/mol. Its IUPAC name is ethyl (1E)-N-(5-bromo-3,4-dicyano-1H-pyrrol-2-yl)methanimidate.
| Compound Name | ethyl (1E)-N-(5-bromo-3,4-dicyano-1H-pyrrol-2-yl)methanimidate |
|---|---|
| PubChem CID | 11119036 |
| Molecular Formula | C9H7BrN4O |
| Molecular Weight | 267.09 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | ethyl (1E)-N-(5-bromo-3,4-dicyano-1H-pyrrol-2-yl)methanimidate |
| SMILES | CCO/C=N/c1[nH]c(Br)c(C#N)c1C#N |
| InChI | InChI=1S/C9H7BrN4O/c1-2-15-5-13-9-7(4-12)6(3-11)8(10)14-9/h5,14H,2H2,1H3/b13-5+ |
| InChIKey | YRRNWMJTNLYXEZ-WLRTZDKTSA-N |
| XLogP | 2.22 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.09 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|